| Cas No.: | 2271358-65-5 |
| Chemical Name: | UAMC-3203 HCl |
| Synonyms: | UAMC3203 |
| SMILES: | C(S(NCCN1CCNCC1)(=O)=O)1=CC=C(NC2CCCCC2)C(NCC2=CC=CC=C2)=C1.[H]Cl |
| Formula: | C25H38ClN5O2S |
| M.Wt: | 508.122 |
| Sotrage: | 2 years -20°C Powder, 2 weeks4°C in DMSO,6 months-80°C in DMSO |
| Description: | UAMC-3203 hydrochloride is a potent and selective Ferroptosis inhibitor with an IC50 of 12 nM[1]. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
